C21H29N5O5 — CID 175734994
(2S)-6-amino-2-[[(2S)-2-[(2-aminoacetyl)amino]propanoyl]amino]-N-(4-methyl-2-oxochromen-7-yl)hexanamide (PubChem CID 175734994) has the molecular formula C21H29N5O5 and a molecular weight of 431.49 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(2S)-2-[(2-aminoacetyl)amino]propanoyl]amino]-N-(4-methyl-2-oxochromen-7-yl)hexanamide.
| Compound Name | (2S)-6-amino-2-[[(2S)-2-[(2-aminoacetyl)amino]propanoyl]amino]-N-(4-methyl-2-oxochromen-7-yl)hexanamide |
|---|---|
| PubChem CID | 175734994 |
| Molecular Formula | C21H29N5O5 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | (2S)-6-amino-2-[[(2S)-2-[(2-aminoacetyl)amino]propanoyl]amino]-N-(4-methyl-2-oxochromen-7-yl)hexanamide |
| SMILES | Cc1cc(=O)oc2cc(NC(=O)[C@H](CCCCN)NC(=O)[C@H](C)NC(=O)CN)ccc12 |
| InChI | InChI=1S/C21H29N5O5/c1-12-9-19(28)31-17-10-14(6-7-15(12)17)25-21(30)16(5-3-4-8-22)26-20(29)13(2)24-18(27)11-23/h6-7,9-10,13,16H,3-5,8,11,22-23H2,1-2H3,(H,24,27)(H,25,30)(H,26,29)/t13-,16-/m0/s1 |
| InChIKey | YSMMZIASIZLBBA-BBRMVZONSA-N |
| XLogP | 0.12 |
| TPSA | 169.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|