C33H44N8O6 — CID 90663056
(2S)-2-[[(2S)-2-[[(2S)-2-acetamido-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-6-amino-N-(4-methyl-2-oxochromen-7-yl)hexanamide (PubChem CID 90663056) has the molecular formula C33H44N8O6 and a molecular weight of 648.77 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S)-2-acetamido-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-6-amino-N-(4-methyl-2-oxochromen-7-yl)hexanamide.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S)-2-acetamido-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-6-amino-N-(4-methyl-2-oxochromen-7-yl)hexanamide |
|---|---|
| PubChem CID | 90663056 |
| Molecular Formula | C33H44N8O6 |
| Molecular Weight | 648.77 g/mol |
| Exact Mass | 648.34 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-2-acetamido-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-6-amino-N-(4-methyl-2-oxochromen-7-yl)hexanamide |
| SMILES | CC(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)Nc1ccc2c(C)cc(=O)oc2c1 |
| InChI | InChI=1S/C33H44N8O6/c1-20-17-29(43)47-28-19-23(13-14-24(20)28)39-30(44)25(11-6-7-15-34)40-31(45)26(12-8-16-37-33(35)36)41-32(46)27(38-21(2)42)18-22-9-4-3-5-10-22/h3-5,9-10,13-14,17,19,25-27H,6-8,11-12,15-16,18,34H2,1-2H3,(H,38,42)(H,39,44)(H,40,45)(H,41,46)(H4,35,36,37)/t25-,26-,27-/m0/s1 |
| InChIKey | IXWGKXPCDUXVAZ-QKDODKLFSA-N |
| XLogP | 0.94 |
| TPSA | 237.03 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.77 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|