C28H44N8O5 — CID 175691460
(2S)-2,6-diamino-N-[(2S)-1-[[(2S)-5-(diaminomethylideneamino)-1-[(4-methyl-2-oxochromen-7-yl)amino]-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]hexanamide (PubChem CID 175691460) has the molecular formula C28H44N8O5 and a molecular weight of 572.71 g/mol. Its IUPAC name is (2S)-2,6-diamino-N-[(2S)-1-[[(2S)-5-(diaminomethylideneamino)-1-[(4-methyl-2-oxochromen-7-yl)amino]-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]hexanamide.
| Compound Name | (2S)-2,6-diamino-N-[(2S)-1-[[(2S)-5-(diaminomethylideneamino)-1-[(4-methyl-2-oxochromen-7-yl)amino]-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]hexanamide |
|---|---|
| PubChem CID | 175691460 |
| Molecular Formula | C28H44N8O5 |
| Molecular Weight | 572.71 g/mol |
| Exact Mass | 572.34 |
| IUPAC Name | (2S)-2,6-diamino-N-[(2S)-1-[[(2S)-5-(diaminomethylideneamino)-1-[(4-methyl-2-oxochromen-7-yl)amino]-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]hexanamide |
| SMILES | Cc1cc(=O)oc2cc(NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](N)CCCCN)ccc12 |
| InChI | InChI=1S/C28H44N8O5/c1-16(2)13-22(36-25(38)20(30)7-4-5-11-29)27(40)35-21(8-6-12-33-28(31)32)26(39)34-18-9-10-19-17(3)14-24(37)41-23(19)15-18/h9-10,14-16,20-22H,4-8,11-13,29-30H2,1-3H3,(H,34,39)(H,35,40)(H,36,38)(H4,31,32,33)/t20-,21-,22-/m0/s1 |
| InChIKey | UWJOASRACMKBSI-FKBYEOEOSA-N |
| XLogP | 0.57 |
| TPSA | 233.95 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.71 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|