C26H37N5O6 — CID 88863807
(2S)-2-[[2-[[(2S)-2-acetamido-4-methylpentanoyl]amino]acetyl]amino]-6-amino-N-(4-methyl-2-oxochromen-7-yl)hexanamide (PubChem CID 88863807) has the molecular formula C26H37N5O6 and a molecular weight of 515.61 g/mol. Its IUPAC name is (2S)-2-[[2-[[(2S)-2-acetamido-4-methylpentanoyl]amino]acetyl]amino]-6-amino-N-(4-methyl-2-oxochromen-7-yl)hexanamide.
| Compound Name | (2S)-2-[[2-[[(2S)-2-acetamido-4-methylpentanoyl]amino]acetyl]amino]-6-amino-N-(4-methyl-2-oxochromen-7-yl)hexanamide |
|---|---|
| PubChem CID | 88863807 |
| Molecular Formula | C26H37N5O6 |
| Molecular Weight | 515.61 g/mol |
| Exact Mass | 515.27 |
| IUPAC Name | (2S)-2-[[2-[[(2S)-2-acetamido-4-methylpentanoyl]amino]acetyl]amino]-6-amino-N-(4-methyl-2-oxochromen-7-yl)hexanamide |
| SMILES | CC(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N[C@@H](CCCCN)C(=O)Nc1ccc2c(C)cc(=O)oc2c1 |
| InChI | InChI=1S/C26H37N5O6/c1-15(2)11-21(29-17(4)32)25(35)28-14-23(33)31-20(7-5-6-10-27)26(36)30-18-8-9-19-16(3)12-24(34)37-22(19)13-18/h8-9,12-13,15,20-21H,5-7,10-11,14,27H2,1-4H3,(H,28,35)(H,29,32)(H,30,36)(H,31,33)/t20-,21-/m0/s1 |
| InChIKey | DMCYFKPOQPRZCG-SFTDATJTSA-N |
| XLogP | 1.32 |
| TPSA | 172.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.61 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|