C29H44N8O6 — CID 23349534
2-[(2-amino-3-methylbutanoyl)amino]-N-[2-[[5-(diaminomethylideneamino)-1-[(4-methyl-2-oxochromen-7-yl)amino]-1-oxopentan-2-yl]amino]-2-oxoethyl]-4-methylpentanamide (PubChem CID 23349534) has the molecular formula C29H44N8O6 and a molecular weight of 600.72 g/mol. Its IUPAC name is 2-[(2-amino-3-methylbutanoyl)amino]-N-[2-[[5-(diaminomethylideneamino)-1-[(4-methyl-2-oxochromen-7-yl)amino]-1-oxopentan-2-yl]amino]-2-oxoethyl]-4-methylpentanamide.
| Compound Name | 2-[(2-amino-3-methylbutanoyl)amino]-N-[2-[[5-(diaminomethylideneamino)-1-[(4-methyl-2-oxochromen-7-yl)amino]-1-oxopentan-2-yl]amino]-2-oxoethyl]-4-methylpentanamide |
|---|---|
| PubChem CID | 23349534 |
| Molecular Formula | C29H44N8O6 |
| Molecular Weight | 600.72 g/mol |
| Exact Mass | 600.34 |
| IUPAC Name | 2-[(2-amino-3-methylbutanoyl)amino]-N-[2-[[5-(diaminomethylideneamino)-1-[(4-methyl-2-oxochromen-7-yl)amino]-1-oxopentan-2-yl]amino]-2-oxoethyl]-4-methylpentanamide |
| SMILES | Cc1cc(=O)oc2cc(NC(=O)C(CCCN=C(N)N)NC(=O)CNC(=O)C(CC(C)C)NC(=O)C(N)C(C)C)ccc12 |
| InChI | InChI=1S/C29H44N8O6/c1-15(2)11-21(37-28(42)25(30)16(3)4)26(40)34-14-23(38)36-20(7-6-10-33-29(31)32)27(41)35-18-8-9-19-17(5)12-24(39)43-22(19)13-18/h8-9,12-13,15-16,20-21,25H,6-7,10-11,14,30H2,1-5H3,(H,34,40)(H,35,41)(H,36,38)(H,37,42)(H4,31,32,33) |
| InChIKey | KDIUOMXHXPXCRQ-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 237.03 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.72 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|