C24H27N5O4 — CID 25255458
(2S)-5-(diaminomethylideneamino)-N-(4-methyl-2-oxochromen-7-yl)-2-(phenacylamino)pentanamide (PubChem CID 25255458) has the molecular formula C24H27N5O4 and a molecular weight of 449.51 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-N-(4-methyl-2-oxochromen-7-yl)-2-(phenacylamino)pentanamide.
| Compound Name | (2S)-5-(diaminomethylideneamino)-N-(4-methyl-2-oxochromen-7-yl)-2-(phenacylamino)pentanamide |
|---|---|
| PubChem CID | 25255458 |
| Molecular Formula | C24H27N5O4 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-N-(4-methyl-2-oxochromen-7-yl)-2-(phenacylamino)pentanamide |
| SMILES | Cc1cc(=O)oc2cc(NC(=O)[C@H](CCCN=C(N)N)NCC(=O)c3ccccc3)ccc12 |
| InChI | InChI=1S/C24H27N5O4/c1-15-12-22(31)33-21-13-17(9-10-18(15)21)29-23(32)19(8-5-11-27-24(25)26)28-14-20(30)16-6-3-2-4-7-16/h2-4,6-7,9-10,12-13,19,28H,5,8,11,14H2,1H3,(H,29,32)(H4,25,26,27)/t19-/m0/s1 |
| InChIKey | YCVBMYFZECAGEN-IBGZPJMESA-N |
| XLogP | 1.93 |
| TPSA | 152.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|