C22H21NO7 — CID 46795057
[7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl 2-(2-methoxyphenyl)acetate (PubChem CID 46795057) has the molecular formula C22H21NO7 and a molecular weight of 411.41 g/mol. Its IUPAC name is [7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl 2-(2-methoxyphenyl)acetate.
| Compound Name | [7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl 2-(2-methoxyphenyl)acetate |
|---|---|
| PubChem CID | 46795057 |
| Molecular Formula | C22H21NO7 |
| Molecular Weight | 411.41 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | [7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl 2-(2-methoxyphenyl)acetate |
| SMILES | CCOC(=O)Nc1ccc2c(COC(=O)Cc3ccccc3OC)cc(=O)oc2c1 |
| InChI | InChI=1S/C22H21NO7/c1-3-28-22(26)23-16-8-9-17-15(11-21(25)30-19(17)12-16)13-29-20(24)10-14-6-4-5-7-18(14)27-2/h4-9,11-12H,3,10,13H2,1-2H3,(H,23,26) |
| InChIKey | YBMPOPGGOYVLRC-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 104.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.41 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|