C22H21F3N2O5 — CID 43049888
ethyl N-[4-[[methyl-[[2-(trifluoromethoxy)phenyl]methyl]amino]methyl]-2-oxochromen-7-yl]carbamate (PubChem CID 43049888) has the molecular formula C22H21F3N2O5 and a molecular weight of 450.41 g/mol. Its IUPAC name is ethyl N-[4-[[methyl-[[2-(trifluoromethoxy)phenyl]methyl]amino]methyl]-2-oxochromen-7-yl]carbamate.
| Compound Name | ethyl N-[4-[[methyl-[[2-(trifluoromethoxy)phenyl]methyl]amino]methyl]-2-oxochromen-7-yl]carbamate |
|---|---|
| PubChem CID | 43049888 |
| Molecular Formula | C22H21F3N2O5 |
| Molecular Weight | 450.41 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | ethyl N-[4-[[methyl-[[2-(trifluoromethoxy)phenyl]methyl]amino]methyl]-2-oxochromen-7-yl]carbamate |
| SMILES | CCOC(=O)Nc1ccc2c(CN(C)Cc3ccccc3OC(F)(F)F)cc(=O)oc2c1 |
| InChI | InChI=1S/C22H21F3N2O5/c1-3-30-21(29)26-16-8-9-17-15(10-20(28)31-19(17)11-16)13-27(2)12-14-6-4-5-7-18(14)32-22(23,24)25/h4-11H,3,12-13H2,1-2H3,(H,26,29) |
| InChIKey | RYRUYGLBOCYGLS-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.41 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|