C24H27N3O5 — CID 55351227
ethyl N-[4-[[[2-(2-ethylanilino)-2-oxoethyl]-methylamino]methyl]-2-oxochromen-7-yl]carbamate (PubChem CID 55351227) has the molecular formula C24H27N3O5 and a molecular weight of 437.50 g/mol. Its IUPAC name is ethyl N-[4-[[[2-(2-ethylanilino)-2-oxoethyl]-methylamino]methyl]-2-oxochromen-7-yl]carbamate.
| Compound Name | ethyl N-[4-[[[2-(2-ethylanilino)-2-oxoethyl]-methylamino]methyl]-2-oxochromen-7-yl]carbamate |
|---|---|
| PubChem CID | 55351227 |
| Molecular Formula | C24H27N3O5 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | ethyl N-[4-[[[2-(2-ethylanilino)-2-oxoethyl]-methylamino]methyl]-2-oxochromen-7-yl]carbamate |
| SMILES | CCOC(=O)Nc1ccc2c(CN(C)CC(=O)Nc3ccccc3CC)cc(=O)oc2c1 |
| InChI | InChI=1S/C24H27N3O5/c1-4-16-8-6-7-9-20(16)26-22(28)15-27(3)14-17-12-23(29)32-21-13-18(10-11-19(17)21)25-24(30)31-5-2/h6-13H,4-5,14-15H2,1-3H3,(H,25,30)(H,26,28) |
| InChIKey | MFNQHMNAPNIHNR-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|