C22H25N2O5+ — CID 8016852
[7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl-[(1S)-1-(2-methoxyphenyl)ethyl]azanium (PubChem CID 8016852) has the molecular formula C22H25N2O5+ and a molecular weight of 397.45 g/mol. Its IUPAC name is [7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl-[(1S)-1-(2-methoxyphenyl)ethyl]azanium.
| Compound Name | [7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl-[(1S)-1-(2-methoxyphenyl)ethyl]azanium |
|---|---|
| PubChem CID | 8016852 |
| Molecular Formula | C22H25N2O5+ |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | [7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl-[(1S)-1-(2-methoxyphenyl)ethyl]azanium |
| SMILES | CCOC(=O)Nc1ccc2c(C[NH2+][C@@H](C)c3ccccc3OC)cc(=O)oc2c1 |
| InChI | InChI=1S/C22H24N2O5/c1-4-28-22(26)24-16-9-10-18-15(11-21(25)29-20(18)12-16)13-23-14(2)17-7-5-6-8-19(17)27-3/h5-12,14,23H,4,13H2,1-3H3,(H,24,26)/p+1/t14-/m0/s1 |
| InChIKey | NKGODIXCUZZCTK-AWEZNQCLSA-O |
| XLogP | 3.19 |
| TPSA | 94.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|