C23H24N2O5 — CID 46405824
ethyl N-[4-[(8-methoxy-3,4-dihydro-2H-quinolin-1-yl)methyl]-2-oxochromen-7-yl]carbamate (PubChem CID 46405824) has the molecular formula C23H24N2O5 and a molecular weight of 408.45 g/mol. Its IUPAC name is ethyl N-[4-[(8-methoxy-3,4-dihydro-2H-quinolin-1-yl)methyl]-2-oxochromen-7-yl]carbamate.
| Compound Name | ethyl N-[4-[(8-methoxy-3,4-dihydro-2H-quinolin-1-yl)methyl]-2-oxochromen-7-yl]carbamate |
|---|---|
| PubChem CID | 46405824 |
| Molecular Formula | C23H24N2O5 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | ethyl N-[4-[(8-methoxy-3,4-dihydro-2H-quinolin-1-yl)methyl]-2-oxochromen-7-yl]carbamate |
| SMILES | CCOC(=O)Nc1ccc2c(CN3CCCc4cccc(OC)c43)cc(=O)oc2c1 |
| InChI | InChI=1S/C23H24N2O5/c1-3-29-23(27)24-17-9-10-18-16(12-21(26)30-20(18)13-17)14-25-11-5-7-15-6-4-8-19(28-2)22(15)25/h4,6,8-10,12-13H,3,5,7,11,14H2,1-2H3,(H,24,27) |
| InChIKey | SNDSKLUIEUMNIV-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|