C20H16BrN5O4 — CID 46806716
ethyl N-[4-[[5-(4-bromophenyl)tetrazol-2-yl]methyl]-2-oxochromen-7-yl]carbamate (PubChem CID 46806716) has the molecular formula C20H16BrN5O4 and a molecular weight of 470.28 g/mol. Its IUPAC name is ethyl N-[4-[[5-(4-bromophenyl)tetrazol-2-yl]methyl]-2-oxochromen-7-yl]carbamate.
| Compound Name | ethyl N-[4-[[5-(4-bromophenyl)tetrazol-2-yl]methyl]-2-oxochromen-7-yl]carbamate |
|---|---|
| PubChem CID | 46806716 |
| Molecular Formula | C20H16BrN5O4 |
| Molecular Weight | 470.28 g/mol |
| Exact Mass | 469.04 |
| IUPAC Name | ethyl N-[4-[[5-(4-bromophenyl)tetrazol-2-yl]methyl]-2-oxochromen-7-yl]carbamate |
| SMILES | CCOC(=O)Nc1ccc2c(Cn3nnc(-c4ccc(Br)cc4)n3)cc(=O)oc2c1 |
| InChI | InChI=1S/C20H16BrN5O4/c1-2-29-20(28)22-15-7-8-16-13(9-18(27)30-17(16)10-15)11-26-24-19(23-25-26)12-3-5-14(21)6-4-12/h3-10H,2,11H2,1H3,(H,22,28) |
| InChIKey | VWWPYYBSRVOFPR-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 112.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.28 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|