C22H21NO6 — CID 7775602
[7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl 4-ethylbenzoate (PubChem CID 7775602) has the molecular formula C22H21NO6 and a molecular weight of 395.41 g/mol. Its IUPAC name is [7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl 4-ethylbenzoate.
| Compound Name | [7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl 4-ethylbenzoate |
|---|---|
| PubChem CID | 7775602 |
| Molecular Formula | C22H21NO6 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | [7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl 4-ethylbenzoate |
| SMILES | CCOC(=O)Nc1ccc2c(COC(=O)c3ccc(CC)cc3)cc(=O)oc2c1 |
| InChI | InChI=1S/C22H21NO6/c1-3-14-5-7-15(8-6-14)21(25)28-13-16-11-20(24)29-19-12-17(9-10-18(16)19)23-22(26)27-4-2/h5-12H,3-4,13H2,1-2H3,(H,23,26) |
| InChIKey | FFWNLJNDQIZSIU-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|