C23H21N3O8S — CID 55378936
[7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl 4-(2-cyanoethylsulfamoyl)benzoate (PubChem CID 55378936) has the molecular formula C23H21N3O8S and a molecular weight of 499.50 g/mol. Its IUPAC name is [7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl 4-(2-cyanoethylsulfamoyl)benzoate.
| Compound Name | [7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl 4-(2-cyanoethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 55378936 |
| Molecular Formula | C23H21N3O8S |
| Molecular Weight | 499.50 g/mol |
| Exact Mass | 499.10 |
| IUPAC Name | [7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl 4-(2-cyanoethylsulfamoyl)benzoate |
| SMILES | CCOC(=O)Nc1ccc2c(COC(=O)c3ccc(S(=O)(=O)NCCC#N)cc3)cc(=O)oc2c1 |
| InChI | InChI=1S/C23H21N3O8S/c1-2-32-23(29)26-17-6-9-19-16(12-21(27)34-20(19)13-17)14-33-22(28)15-4-7-18(8-5-15)35(30,31)25-11-3-10-24/h4-9,12-13,25H,2-3,11,14H2,1H3,(H,26,29) |
| InChIKey | ASAOLJUBKKPZLB-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 164.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.50 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|