C22H20N2O6S — CID 30995688
(6,7-dimethyl-2-oxochromen-4-yl)methyl 4-(2-cyanoethylsulfamoyl)benzoate (PubChem CID 30995688) has the molecular formula C22H20N2O6S and a molecular weight of 440.48 g/mol. Its IUPAC name is (6,7-dimethyl-2-oxochromen-4-yl)methyl 4-(2-cyanoethylsulfamoyl)benzoate.
| Compound Name | (6,7-dimethyl-2-oxochromen-4-yl)methyl 4-(2-cyanoethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 30995688 |
| Molecular Formula | C22H20N2O6S |
| Molecular Weight | 440.48 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | (6,7-dimethyl-2-oxochromen-4-yl)methyl 4-(2-cyanoethylsulfamoyl)benzoate |
| SMILES | Cc1cc2oc(=O)cc(COC(=O)c3ccc(S(=O)(=O)NCCC#N)cc3)c2cc1C |
| InChI | InChI=1S/C22H20N2O6S/c1-14-10-19-17(12-21(25)30-20(19)11-15(14)2)13-29-22(26)16-4-6-18(7-5-16)31(27,28)24-9-3-8-23/h4-7,10-12,24H,3,9,13H2,1-2H3 |
| InChIKey | NYVKVZNJHDUWCK-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 126.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.48 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|