C19H16N2O6 — CID 7891148
(6,7-dimethyl-2-oxochromen-4-yl)methyl 4-amino-3-nitrobenzoate (PubChem CID 7891148) has the molecular formula C19H16N2O6 and a molecular weight of 368.35 g/mol. Its IUPAC name is (6,7-dimethyl-2-oxochromen-4-yl)methyl 4-amino-3-nitrobenzoate.
| Compound Name | (6,7-dimethyl-2-oxochromen-4-yl)methyl 4-amino-3-nitrobenzoate |
|---|---|
| PubChem CID | 7891148 |
| Molecular Formula | C19H16N2O6 |
| Molecular Weight | 368.35 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | (6,7-dimethyl-2-oxochromen-4-yl)methyl 4-amino-3-nitrobenzoate |
| SMILES | Cc1cc2oc(=O)cc(COC(=O)c3ccc(N)c([N+](=O)[O-])c3)c2cc1C |
| InChI | InChI=1S/C19H16N2O6/c1-10-5-14-13(8-18(22)27-17(14)6-11(10)2)9-26-19(23)12-3-4-15(20)16(7-12)21(24)25/h3-8H,9,20H2,1-2H3 |
| InChIKey | BYLYDGVGKRCPFL-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 125.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.35 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|