C20H15NO8 — CID 18194061
(6,7-dimethyl-2-oxochromen-4-yl)methyl 6-nitro-1,3-benzodioxole-5-carboxylate (PubChem CID 18194061) has the molecular formula C20H15NO8 and a molecular weight of 397.34 g/mol. Its IUPAC name is (6,7-dimethyl-2-oxochromen-4-yl)methyl 6-nitro-1,3-benzodioxole-5-carboxylate.
| Compound Name | (6,7-dimethyl-2-oxochromen-4-yl)methyl 6-nitro-1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 18194061 |
| Molecular Formula | C20H15NO8 |
| Molecular Weight | 397.34 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | (6,7-dimethyl-2-oxochromen-4-yl)methyl 6-nitro-1,3-benzodioxole-5-carboxylate |
| SMILES | Cc1cc2oc(=O)cc(COC(=O)c3cc4c(cc3[N+](=O)[O-])OCO4)c2cc1C |
| InChI | InChI=1S/C20H15NO8/c1-10-3-13-12(5-19(22)29-16(13)4-11(10)2)8-26-20(23)14-6-17-18(28-9-27-17)7-15(14)21(24)25/h3-7H,8-9H2,1-2H3 |
| InChIKey | ZQYGOYOWHZTTDA-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 118.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.34 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|