C16H12FNO7 — CID 18194104
(5-fluoro-2-methoxyphenyl)methyl 6-nitro-1,3-benzodioxole-5-carboxylate (PubChem CID 18194104) has the molecular formula C16H12FNO7 and a molecular weight of 349.27 g/mol. Its IUPAC name is (5-fluoro-2-methoxyphenyl)methyl 6-nitro-1,3-benzodioxole-5-carboxylate.
| Compound Name | (5-fluoro-2-methoxyphenyl)methyl 6-nitro-1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 18194104 |
| Molecular Formula | C16H12FNO7 |
| Molecular Weight | 349.27 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | (5-fluoro-2-methoxyphenyl)methyl 6-nitro-1,3-benzodioxole-5-carboxylate |
| SMILES | COc1ccc(F)cc1COC(=O)c1cc2c(cc1[N+](=O)[O-])OCO2 |
| InChI | InChI=1S/C16H12FNO7/c1-22-13-3-2-10(17)4-9(13)7-23-16(19)11-5-14-15(25-8-24-14)6-12(11)18(20)21/h2-6H,7-8H2,1H3 |
| InChIKey | ODNNVSSWJNIFDO-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.27 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|