C17H12F2N2O7 — CID 18092088
[1-(2,5-difluoroanilino)-1-oxopropan-2-yl] 6-nitro-1,3-benzodioxole-5-carboxylate (PubChem CID 18092088) has the molecular formula C17H12F2N2O7 and a molecular weight of 394.29 g/mol. Its IUPAC name is [1-(2,5-difluoroanilino)-1-oxopropan-2-yl] 6-nitro-1,3-benzodioxole-5-carboxylate.
| Compound Name | [1-(2,5-difluoroanilino)-1-oxopropan-2-yl] 6-nitro-1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 18092088 |
| Molecular Formula | C17H12F2N2O7 |
| Molecular Weight | 394.29 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | [1-(2,5-difluoroanilino)-1-oxopropan-2-yl] 6-nitro-1,3-benzodioxole-5-carboxylate |
| SMILES | CC(OC(=O)c1cc2c(cc1[N+](=O)[O-])OCO2)C(=O)Nc1cc(F)ccc1F |
| InChI | InChI=1S/C17H12F2N2O7/c1-8(16(22)20-12-4-9(18)2-3-11(12)19)28-17(23)10-5-14-15(27-7-26-14)6-13(10)21(24)25/h2-6,8H,7H2,1H3,(H,20,22) |
| InChIKey | YYBRRPKNHBHOSW-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.29 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|