C21H21NO7 — CID 18194060
[1-(4-tert-butylphenyl)-1-oxopropan-2-yl] 6-nitro-1,3-benzodioxole-5-carboxylate (PubChem CID 18194060) has the molecular formula C21H21NO7 and a molecular weight of 399.40 g/mol. Its IUPAC name is [1-(4-tert-butylphenyl)-1-oxopropan-2-yl] 6-nitro-1,3-benzodioxole-5-carboxylate.
| Compound Name | [1-(4-tert-butylphenyl)-1-oxopropan-2-yl] 6-nitro-1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 18194060 |
| Molecular Formula | C21H21NO7 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | [1-(4-tert-butylphenyl)-1-oxopropan-2-yl] 6-nitro-1,3-benzodioxole-5-carboxylate |
| SMILES | CC(OC(=O)c1cc2c(cc1[N+](=O)[O-])OCO2)C(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C21H21NO7/c1-12(19(23)13-5-7-14(8-6-13)21(2,3)4)29-20(24)15-9-17-18(28-11-27-17)10-16(15)22(25)26/h5-10,12H,11H2,1-4H3 |
| InChIKey | SCTBHBHAKPYBQP-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|