C18H22N2O7 — CID 8940151
[(2S)-1-(azepan-1-yl)-1-oxopropan-2-yl] 6-nitro-2,3-dihydro-1,4-benzodioxine-7-carboxylate (PubChem CID 8940151) has the molecular formula C18H22N2O7 and a molecular weight of 378.38 g/mol. Its IUPAC name is [(2S)-1-(azepan-1-yl)-1-oxopropan-2-yl] 6-nitro-2,3-dihydro-1,4-benzodioxine-7-carboxylate.
| Compound Name | [(2S)-1-(azepan-1-yl)-1-oxopropan-2-yl] 6-nitro-2,3-dihydro-1,4-benzodioxine-7-carboxylate |
|---|---|
| PubChem CID | 8940151 |
| Molecular Formula | C18H22N2O7 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | [(2S)-1-(azepan-1-yl)-1-oxopropan-2-yl] 6-nitro-2,3-dihydro-1,4-benzodioxine-7-carboxylate |
| SMILES | C[C@H](OC(=O)c1cc2c(cc1[N+](=O)[O-])OCCO2)C(=O)N1CCCCCC1 |
| InChI | InChI=1S/C18H22N2O7/c1-12(17(21)19-6-4-2-3-5-7-19)27-18(22)13-10-15-16(26-9-8-25-15)11-14(13)20(23)24/h10-12H,2-9H2,1H3/t12-/m0/s1 |
| InChIKey | DOTJVPIQSQTZGN-LBPRGKRZSA-N |
| XLogP | 2.31 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|