C14H15BrN2O5 — CID 18080334
(1-oxo-1-pyrrolidin-1-ylpropan-2-yl) 4-bromo-3-nitrobenzoate (PubChem CID 18080334) has the molecular formula C14H15BrN2O5 and a molecular weight of 371.19 g/mol. Its IUPAC name is (1-oxo-1-pyrrolidin-1-ylpropan-2-yl) 4-bromo-3-nitrobenzoate.
| Compound Name | (1-oxo-1-pyrrolidin-1-ylpropan-2-yl) 4-bromo-3-nitrobenzoate |
|---|---|
| PubChem CID | 18080334 |
| Molecular Formula | C14H15BrN2O5 |
| Molecular Weight | 371.19 g/mol |
| Exact Mass | 370.02 |
| IUPAC Name | (1-oxo-1-pyrrolidin-1-ylpropan-2-yl) 4-bromo-3-nitrobenzoate |
| SMILES | CC(OC(=O)c1ccc(Br)c([N+](=O)[O-])c1)C(=O)N1CCCC1 |
| InChI | InChI=1S/C14H15BrN2O5/c1-9(13(18)16-6-2-3-7-16)22-14(19)10-4-5-11(15)12(8-10)17(20)21/h4-5,8-9H,2-3,6-7H2,1H3 |
| InChIKey | ASVHEVQECUBENY-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.19 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|