C15H18N2O5 — CID 7759653
[(2R)-1-oxo-1-pyrrolidin-1-ylpropan-2-yl] 3-methyl-4-nitrobenzoate (PubChem CID 7759653) has the molecular formula C15H18N2O5 and a molecular weight of 306.32 g/mol. Its IUPAC name is [(2R)-1-oxo-1-pyrrolidin-1-ylpropan-2-yl] 3-methyl-4-nitrobenzoate.
| Compound Name | [(2R)-1-oxo-1-pyrrolidin-1-ylpropan-2-yl] 3-methyl-4-nitrobenzoate |
|---|---|
| PubChem CID | 7759653 |
| Molecular Formula | C15H18N2O5 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | [(2R)-1-oxo-1-pyrrolidin-1-ylpropan-2-yl] 3-methyl-4-nitrobenzoate |
| SMILES | Cc1cc(C(=O)O[C@H](C)C(=O)N2CCCC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H18N2O5/c1-10-9-12(5-6-13(10)17(20)21)15(19)22-11(2)14(18)16-7-3-4-8-16/h5-6,9,11H,3-4,7-8H2,1-2H3/t11-/m1/s1 |
| InChIKey | ONEJCTSDURJMME-LLVKDONJSA-N |
| XLogP | 2.07 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|