C19H26N2O5 — CID 8630134
[(2R)-1-[cyclohexyl(ethyl)amino]-1-oxopropan-2-yl] 3-methyl-4-nitrobenzoate (PubChem CID 8630134) has the molecular formula C19H26N2O5 and a molecular weight of 362.43 g/mol. Its IUPAC name is [(2R)-1-[cyclohexyl(ethyl)amino]-1-oxopropan-2-yl] 3-methyl-4-nitrobenzoate.
| Compound Name | [(2R)-1-[cyclohexyl(ethyl)amino]-1-oxopropan-2-yl] 3-methyl-4-nitrobenzoate |
|---|---|
| PubChem CID | 8630134 |
| Molecular Formula | C19H26N2O5 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | [(2R)-1-[cyclohexyl(ethyl)amino]-1-oxopropan-2-yl] 3-methyl-4-nitrobenzoate |
| SMILES | CCN(C(=O)[C@@H](C)OC(=O)c1ccc([N+](=O)[O-])c(C)c1)C1CCCCC1 |
| InChI | InChI=1S/C19H26N2O5/c1-4-20(16-8-6-5-7-9-16)18(22)14(3)26-19(23)15-10-11-17(21(24)25)13(2)12-15/h10-12,14,16H,4-9H2,1-3H3/t14-/m1/s1 |
| InChIKey | PGWORKQNWXVAAU-CQSZACIVSA-N |
| XLogP | 3.63 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|