C16H19ClN2O7S — CID 18284288
[1-[(1,1-dioxothiolan-3-yl)-ethylamino]-1-oxopropan-2-yl] 4-chloro-2-nitrobenzoate (PubChem CID 18284288) has the molecular formula C16H19ClN2O7S and a molecular weight of 418.86 g/mol. Its IUPAC name is [1-[(1,1-dioxothiolan-3-yl)-ethylamino]-1-oxopropan-2-yl] 4-chloro-2-nitrobenzoate.
| Compound Name | [1-[(1,1-dioxothiolan-3-yl)-ethylamino]-1-oxopropan-2-yl] 4-chloro-2-nitrobenzoate |
|---|---|
| PubChem CID | 18284288 |
| Molecular Formula | C16H19ClN2O7S |
| Molecular Weight | 418.86 g/mol |
| Exact Mass | 418.06 |
| IUPAC Name | [1-[(1,1-dioxothiolan-3-yl)-ethylamino]-1-oxopropan-2-yl] 4-chloro-2-nitrobenzoate |
| SMILES | CCN(C(=O)C(C)OC(=O)c1ccc(Cl)cc1[N+](=O)[O-])C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H19ClN2O7S/c1-3-18(12-6-7-27(24,25)9-12)15(20)10(2)26-16(21)13-5-4-11(17)8-14(13)19(22)23/h4-5,8,10,12H,3,6-7,9H2,1-2H3 |
| InChIKey | RXASUQCXDJVDDD-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 123.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.86 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|