C16H17ClN2O7S — CID 7697367
[2-[cyclopropyl-[(3R)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] 4-chloro-2-nitrobenzoate (PubChem CID 7697367) has the molecular formula C16H17ClN2O7S and a molecular weight of 416.84 g/mol. Its IUPAC name is [2-[cyclopropyl-[(3R)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] 4-chloro-2-nitrobenzoate.
| Compound Name | [2-[cyclopropyl-[(3R)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] 4-chloro-2-nitrobenzoate |
|---|---|
| PubChem CID | 7697367 |
| Molecular Formula | C16H17ClN2O7S |
| Molecular Weight | 416.84 g/mol |
| Exact Mass | 416.04 |
| IUPAC Name | [2-[cyclopropyl-[(3R)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] 4-chloro-2-nitrobenzoate |
| SMILES | O=C(OCC(=O)N(C1CC1)[C@@H]1CCS(=O)(=O)C1)c1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H17ClN2O7S/c17-10-1-4-13(14(7-10)19(22)23)16(21)26-8-15(20)18(11-2-3-11)12-5-6-27(24,25)9-12/h1,4,7,11-12H,2-3,5-6,8-9H2/t12-/m1/s1 |
| InChIKey | VPQPGEUVPIYWID-GFCCVEGCSA-N |
| XLogP | 1.58 |
| TPSA | 123.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.84 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|