C17H24ClN3O5S — CID 112795894
4-chloro-N-[2-(diethylamino)ethyl]-N-(1,1-dioxothiolan-3-yl)-2-nitrobenzamide (PubChem CID 112795894) has the molecular formula C17H24ClN3O5S and a molecular weight of 417.92 g/mol. Its IUPAC name is 4-chloro-N-[2-(diethylamino)ethyl]-N-(1,1-dioxothiolan-3-yl)-2-nitrobenzamide.
| Compound Name | 4-chloro-N-[2-(diethylamino)ethyl]-N-(1,1-dioxothiolan-3-yl)-2-nitrobenzamide |
|---|---|
| PubChem CID | 112795894 |
| Molecular Formula | C17H24ClN3O5S |
| Molecular Weight | 417.92 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | 4-chloro-N-[2-(diethylamino)ethyl]-N-(1,1-dioxothiolan-3-yl)-2-nitrobenzamide |
| SMILES | CCN(CC)CCN(C(=O)c1ccc(Cl)cc1[N+](=O)[O-])C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H24ClN3O5S/c1-3-19(4-2)8-9-20(14-7-10-27(25,26)12-14)17(22)15-6-5-13(18)11-16(15)21(23)24/h5-6,11,14H,3-4,7-10,12H2,1-2H3 |
| InChIKey | BWIQEYYFFXMVGB-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.92 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|