C20H30ClN3O3 — CID 56535329
N-butyl-4-chloro-2-nitro-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzamide (PubChem CID 56535329) has the molecular formula C20H30ClN3O3 and a molecular weight of 395.93 g/mol. Its IUPAC name is N-butyl-4-chloro-2-nitro-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzamide.
| Compound Name | N-butyl-4-chloro-2-nitro-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzamide |
|---|---|
| PubChem CID | 56535329 |
| Molecular Formula | C20H30ClN3O3 |
| Molecular Weight | 395.93 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | N-butyl-4-chloro-2-nitro-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzamide |
| SMILES | CCCCN(C(=O)c1ccc(Cl)cc1[N+](=O)[O-])C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C20H30ClN3O3/c1-6-7-10-23(15-12-19(2,3)22-20(4,5)13-15)18(25)16-9-8-14(21)11-17(16)24(26)27/h8-9,11,15,22H,6-7,10,12-13H2,1-5H3 |
| InChIKey | KNXYVLYWVUISOJ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.93 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|