C18H26N2O8S — CID 55467375
N-(1,1-dioxothiolan-3-yl)-5-methoxy-4-(2-methoxyethoxy)-2-nitro-N-propylbenzamide (PubChem CID 55467375) has the molecular formula C18H26N2O8S and a molecular weight of 430.48 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-5-methoxy-4-(2-methoxyethoxy)-2-nitro-N-propylbenzamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-5-methoxy-4-(2-methoxyethoxy)-2-nitro-N-propylbenzamide |
|---|---|
| PubChem CID | 55467375 |
| Molecular Formula | C18H26N2O8S |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-5-methoxy-4-(2-methoxyethoxy)-2-nitro-N-propylbenzamide |
| SMILES | CCCN(C(=O)c1cc(OC)c(OCCOC)cc1[N+](=O)[O-])C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H26N2O8S/c1-4-6-19(13-5-9-29(24,25)12-13)18(21)14-10-16(27-3)17(28-8-7-26-2)11-15(14)20(22)23/h10-11,13H,4-9,12H2,1-3H3 |
| InChIKey | QDKXVGBUMZYSBG-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 125.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|