C15H20N2O5S — CID 78789212
N-(1,1-dioxothiolan-3-yl)-2-(2-nitrophenyl)-N-propylacetamide (PubChem CID 78789212) has the molecular formula C15H20N2O5S and a molecular weight of 340.40 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2-(2-nitrophenyl)-N-propylacetamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2-(2-nitrophenyl)-N-propylacetamide |
|---|---|
| PubChem CID | 78789212 |
| Molecular Formula | C15H20N2O5S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2-(2-nitrophenyl)-N-propylacetamide |
| SMILES | CCCN(C(=O)Cc1ccccc1[N+](=O)[O-])C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H20N2O5S/c1-2-8-16(13-7-9-23(21,22)11-13)15(18)10-12-5-3-4-6-14(12)17(19)20/h3-6,13H,2,7-11H2,1H3 |
| InChIKey | SNEVMZNMTWJNHI-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|