C12H14N2O5S — CID 7259784
N-[(3S)-1,1-dioxothiolan-3-yl]-N-methyl-2-nitrobenzamide (PubChem CID 7259784) has the molecular formula C12H14N2O5S and a molecular weight of 298.32 g/mol. Its IUPAC name is N-[(3S)-1,1-dioxothiolan-3-yl]-N-methyl-2-nitrobenzamide.
| Compound Name | N-[(3S)-1,1-dioxothiolan-3-yl]-N-methyl-2-nitrobenzamide |
|---|---|
| PubChem CID | 7259784 |
| Molecular Formula | C12H14N2O5S |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | N-[(3S)-1,1-dioxothiolan-3-yl]-N-methyl-2-nitrobenzamide |
| SMILES | CN(C(=O)c1ccccc1[N+](=O)[O-])[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H14N2O5S/c1-13(9-6-7-20(18,19)8-9)12(15)10-4-2-3-5-11(10)14(16)17/h2-5,9H,6-8H2,1H3/t9-/m0/s1 |
| InChIKey | RRGLJLZJHURFMO-VIFPVBQESA-N |
| XLogP | 0.85 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|