C12H14BrNO3S — CID 7259715
2-bromo-N-[(3R)-1,1-dioxothiolan-3-yl]-N-methylbenzamide (PubChem CID 7259715) has the molecular formula C12H14BrNO3S and a molecular weight of 332.22 g/mol. Its IUPAC name is 2-bromo-N-[(3R)-1,1-dioxothiolan-3-yl]-N-methylbenzamide.
| Compound Name | 2-bromo-N-[(3R)-1,1-dioxothiolan-3-yl]-N-methylbenzamide |
|---|---|
| PubChem CID | 7259715 |
| Molecular Formula | C12H14BrNO3S |
| Molecular Weight | 332.22 g/mol |
| Exact Mass | 330.99 |
| IUPAC Name | 2-bromo-N-[(3R)-1,1-dioxothiolan-3-yl]-N-methylbenzamide |
| SMILES | CN(C(=O)c1ccccc1Br)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H14BrNO3S/c1-14(9-6-7-18(16,17)8-9)12(15)10-4-2-3-5-11(10)13/h2-5,9H,6-8H2,1H3/t9-/m1/s1 |
| InChIKey | NUSPDKAMNPKEDI-SECBINFHSA-N |
| XLogP | 1.71 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.22 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |