C11H13BrN2O3S — CID 113343275
6-bromo-N-(1,1-dioxothiolan-3-yl)-N-methylpyridine-2-carboxamide (PubChem CID 113343275) has the molecular formula C11H13BrN2O3S and a molecular weight of 333.21 g/mol. Its IUPAC name is 6-bromo-N-(1,1-dioxothiolan-3-yl)-N-methylpyridine-2-carboxamide.
| Compound Name | 6-bromo-N-(1,1-dioxothiolan-3-yl)-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 113343275 |
| Molecular Formula | C11H13BrN2O3S |
| Molecular Weight | 333.21 g/mol |
| Exact Mass | 331.98 |
| IUPAC Name | 6-bromo-N-(1,1-dioxothiolan-3-yl)-N-methylpyridine-2-carboxamide |
| SMILES | CN(C(=O)c1cccc(Br)n1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H13BrN2O3S/c1-14(8-5-6-18(16,17)7-8)11(15)9-3-2-4-10(12)13-9/h2-4,8H,5-7H2,1H3 |
| InChIKey | XINPFNFHIIGBNG-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.21 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|