C19H19NO4S — CID 7173985
2-benzoyl-N-[(3S)-1,1-dioxothiolan-3-yl]-N-methylbenzamide (PubChem CID 7173985) has the molecular formula C19H19NO4S and a molecular weight of 357.43 g/mol. Its IUPAC name is 2-benzoyl-N-[(3S)-1,1-dioxothiolan-3-yl]-N-methylbenzamide.
| Compound Name | 2-benzoyl-N-[(3S)-1,1-dioxothiolan-3-yl]-N-methylbenzamide |
|---|---|
| PubChem CID | 7173985 |
| Molecular Formula | C19H19NO4S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 2-benzoyl-N-[(3S)-1,1-dioxothiolan-3-yl]-N-methylbenzamide |
| SMILES | CN(C(=O)c1ccccc1C(=O)c1ccccc1)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H19NO4S/c1-20(15-11-12-25(23,24)13-15)19(22)17-10-6-5-9-16(17)18(21)14-7-3-2-4-8-14/h2-10,15H,11-13H2,1H3/t15-/m0/s1 |
| InChIKey | HHRYTQRDSNUPPZ-HNNXBMFYSA-N |
| XLogP | 2.18 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |