C21H23NO5S — CID 24595012
2-(4-benzoylphenoxy)-N-(1,1-dioxothiolan-3-yl)-N-methylpropanamide (PubChem CID 24595012) has the molecular formula C21H23NO5S and a molecular weight of 401.48 g/mol. Its IUPAC name is 2-(4-benzoylphenoxy)-N-(1,1-dioxothiolan-3-yl)-N-methylpropanamide.
| Compound Name | 2-(4-benzoylphenoxy)-N-(1,1-dioxothiolan-3-yl)-N-methylpropanamide |
|---|---|
| PubChem CID | 24595012 |
| Molecular Formula | C21H23NO5S |
| Molecular Weight | 401.48 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | 2-(4-benzoylphenoxy)-N-(1,1-dioxothiolan-3-yl)-N-methylpropanamide |
| SMILES | CC(Oc1ccc(C(=O)c2ccccc2)cc1)C(=O)N(C)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C21H23NO5S/c1-15(21(24)22(2)18-12-13-28(25,26)14-18)27-19-10-8-17(9-11-19)20(23)16-6-4-3-5-7-16/h3-11,15,18H,12-14H2,1-2H3 |
| InChIKey | ZBIZYXKFHGCVKM-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.48 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |