C19H23NO4S — CID 97123561
(2S)-N-(1,1-dioxothian-4-yl)-N-methyl-2-naphthalen-2-yloxypropanamide (PubChem CID 97123561) has the molecular formula C19H23NO4S and a molecular weight of 361.46 g/mol. Its IUPAC name is (2S)-N-(1,1-dioxothian-4-yl)-N-methyl-2-naphthalen-2-yloxypropanamide.
| Compound Name | (2S)-N-(1,1-dioxothian-4-yl)-N-methyl-2-naphthalen-2-yloxypropanamide |
|---|---|
| PubChem CID | 97123561 |
| Molecular Formula | C19H23NO4S |
| Molecular Weight | 361.46 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | (2S)-N-(1,1-dioxothian-4-yl)-N-methyl-2-naphthalen-2-yloxypropanamide |
| SMILES | C[C@H](Oc1ccc2ccccc2c1)C(=O)N(C)C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C19H23NO4S/c1-14(19(21)20(2)17-9-11-25(22,23)12-10-17)24-18-8-7-15-5-3-4-6-16(15)13-18/h3-8,13-14,17H,9-12H2,1-2H3/t14-/m0/s1 |
| InChIKey | DNPIYPSXYCLTPL-AWEZNQCLSA-N |
| XLogP | 2.64 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.46 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |