C12H14BrNO3S2 — CID 107023419
4-bromo-N-(1,1-dioxothiolan-3-yl)-N-methyl-2-sulfanylbenzamide (PubChem CID 107023419) has the molecular formula C12H14BrNO3S2 and a molecular weight of 364.29 g/mol. Its IUPAC name is 4-bromo-N-(1,1-dioxothiolan-3-yl)-N-methyl-2-sulfanylbenzamide.
| Compound Name | 4-bromo-N-(1,1-dioxothiolan-3-yl)-N-methyl-2-sulfanylbenzamide |
|---|---|
| PubChem CID | 107023419 |
| Molecular Formula | C12H14BrNO3S2 |
| Molecular Weight | 364.29 g/mol |
| Exact Mass | 362.96 |
| IUPAC Name | 4-bromo-N-(1,1-dioxothiolan-3-yl)-N-methyl-2-sulfanylbenzamide |
| SMILES | CN(C(=O)c1ccc(Br)cc1S)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H14BrNO3S2/c1-14(9-4-5-19(16,17)7-9)12(15)10-3-2-8(13)6-11(10)18/h2-3,6,9,18H,4-5,7H2,1H3 |
| InChIKey | VRPGUZZIWAWTTA-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 54.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.29 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|