C16H22BrNOS — CID 107032506
4-bromo-N-(4,4-dimethylcyclohexyl)-N-methyl-2-sulfanylbenzamide (PubChem CID 107032506) has the molecular formula C16H22BrNOS and a molecular weight of 356.33 g/mol. Its IUPAC name is 4-bromo-N-(4,4-dimethylcyclohexyl)-N-methyl-2-sulfanylbenzamide.
| Compound Name | 4-bromo-N-(4,4-dimethylcyclohexyl)-N-methyl-2-sulfanylbenzamide |
|---|---|
| PubChem CID | 107032506 |
| Molecular Formula | C16H22BrNOS |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | 4-bromo-N-(4,4-dimethylcyclohexyl)-N-methyl-2-sulfanylbenzamide |
| SMILES | CN(C(=O)c1ccc(Br)cc1S)C1CCC(C)(C)CC1 |
| InChI | InChI=1S/C16H22BrNOS/c1-16(2)8-6-12(7-9-16)18(3)15(19)13-5-4-11(17)10-14(13)20/h4-5,10,12,20H,6-9H2,1-3H3 |
| InChIKey | AVQBQXYYMCHGBZ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|