C12H14BrNO2S — CID 107026297
4-bromo-N-cyclopropyl-N-(2-hydroxyethyl)-2-sulfanylbenzamide (PubChem CID 107026297) has the molecular formula C12H14BrNO2S and a molecular weight of 316.22 g/mol. Its IUPAC name is 4-bromo-N-cyclopropyl-N-(2-hydroxyethyl)-2-sulfanylbenzamide.
| Compound Name | 4-bromo-N-cyclopropyl-N-(2-hydroxyethyl)-2-sulfanylbenzamide |
|---|---|
| PubChem CID | 107026297 |
| Molecular Formula | C12H14BrNO2S |
| Molecular Weight | 316.22 g/mol |
| Exact Mass | 314.99 |
| IUPAC Name | 4-bromo-N-cyclopropyl-N-(2-hydroxyethyl)-2-sulfanylbenzamide |
| SMILES | O=C(c1ccc(Br)cc1S)N(CCO)C1CC1 |
| InChI | InChI=1S/C12H14BrNO2S/c13-8-1-4-10(11(17)7-8)12(16)14(5-6-15)9-2-3-9/h1,4,7,9,15,17H,2-3,5-6H2 |
| InChIKey | DTRWFPOKXDMZRW-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.22 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|