C13H16BrNO3S — CID 65307183
5-bromo-N-(1,1-dioxothiolan-3-yl)-N,2-dimethylbenzamide (PubChem CID 65307183) has the molecular formula C13H16BrNO3S and a molecular weight of 346.25 g/mol. Its IUPAC name is 5-bromo-N-(1,1-dioxothiolan-3-yl)-N,2-dimethylbenzamide.
| Compound Name | 5-bromo-N-(1,1-dioxothiolan-3-yl)-N,2-dimethylbenzamide |
|---|---|
| PubChem CID | 65307183 |
| Molecular Formula | C13H16BrNO3S |
| Molecular Weight | 346.25 g/mol |
| Exact Mass | 345.00 |
| IUPAC Name | 5-bromo-N-(1,1-dioxothiolan-3-yl)-N,2-dimethylbenzamide |
| SMILES | Cc1ccc(Br)cc1C(=O)N(C)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H16BrNO3S/c1-9-3-4-10(14)7-12(9)13(16)15(2)11-5-6-19(17,18)8-11/h3-4,7,11H,5-6,8H2,1-2H3 |
| InChIKey | TVLYIQYEKLSMRI-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.25 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |