C13H17FN2O3S — CID 103295992
5-amino-N-(1,1-dioxothiolan-3-yl)-2-fluoro-N,3-dimethylbenzamide (PubChem CID 103295992) has the molecular formula C13H17FN2O3S and a molecular weight of 300.36 g/mol. Its IUPAC name is 5-amino-N-(1,1-dioxothiolan-3-yl)-2-fluoro-N,3-dimethylbenzamide.
| Compound Name | 5-amino-N-(1,1-dioxothiolan-3-yl)-2-fluoro-N,3-dimethylbenzamide |
|---|---|
| PubChem CID | 103295992 |
| Molecular Formula | C13H17FN2O3S |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 5-amino-N-(1,1-dioxothiolan-3-yl)-2-fluoro-N,3-dimethylbenzamide |
| SMILES | Cc1cc(N)cc(C(=O)N(C)C2CCS(=O)(=O)C2)c1F |
| InChI | InChI=1S/C13H17FN2O3S/c1-8-5-9(15)6-11(12(8)14)13(17)16(2)10-3-4-20(18,19)7-10/h5-6,10H,3-4,7,15H2,1-2H3 |
| InChIKey | LLAIKEZMDCGOSY-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|