C11H12F2N2O3S — CID 105380416
N-(1,1-dioxothiolan-3-yl)-2,3-difluoro-N-methylpyridine-4-carboxamide (PubChem CID 105380416) has the molecular formula C11H12F2N2O3S and a molecular weight of 290.29 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2,3-difluoro-N-methylpyridine-4-carboxamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2,3-difluoro-N-methylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 105380416 |
| Molecular Formula | C11H12F2N2O3S |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2,3-difluoro-N-methylpyridine-4-carboxamide |
| SMILES | CN(C(=O)c1ccnc(F)c1F)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H12F2N2O3S/c1-15(7-3-5-19(17,18)6-7)11(16)8-2-4-14-10(13)9(8)12/h2,4,7H,3,5-6H2,1H3 |
| InChIKey | PCDKGZSJAUBTRW-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|