C11H12ClN3O5S — CID 64865935
2-chloro-N-(1,1-dioxothiolan-3-yl)-N-methyl-3-nitropyridine-4-carboxamide (PubChem CID 64865935) has the molecular formula C11H12ClN3O5S and a molecular weight of 333.75 g/mol. Its IUPAC name is 2-chloro-N-(1,1-dioxothiolan-3-yl)-N-methyl-3-nitropyridine-4-carboxamide.
| Compound Name | 2-chloro-N-(1,1-dioxothiolan-3-yl)-N-methyl-3-nitropyridine-4-carboxamide |
|---|---|
| PubChem CID | 64865935 |
| Molecular Formula | C11H12ClN3O5S |
| Molecular Weight | 333.75 g/mol |
| Exact Mass | 333.02 |
| IUPAC Name | 2-chloro-N-(1,1-dioxothiolan-3-yl)-N-methyl-3-nitropyridine-4-carboxamide |
| SMILES | CN(C(=O)c1ccnc(Cl)c1[N+](=O)[O-])C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H12ClN3O5S/c1-14(7-3-5-21(19,20)6-7)11(16)8-2-4-13-10(12)9(8)15(17)18/h2,4,7H,3,5-6H2,1H3 |
| InChIKey | GPBQEGPPRJUIKQ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 110.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.75 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|