C12H15N3O5S — CID 115548590
3-amino-N-(1,1-dioxothiolan-3-yl)-N-methyl-2-nitrobenzamide (PubChem CID 115548590) has the molecular formula C12H15N3O5S and a molecular weight of 313.33 g/mol. Its IUPAC name is 3-amino-N-(1,1-dioxothiolan-3-yl)-N-methyl-2-nitrobenzamide.
| Compound Name | 3-amino-N-(1,1-dioxothiolan-3-yl)-N-methyl-2-nitrobenzamide |
|---|---|
| PubChem CID | 115548590 |
| Molecular Formula | C12H15N3O5S |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 3-amino-N-(1,1-dioxothiolan-3-yl)-N-methyl-2-nitrobenzamide |
| SMILES | CN(C(=O)c1cccc(N)c1[N+](=O)[O-])C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H15N3O5S/c1-14(8-5-6-21(19,20)7-8)12(16)9-3-2-4-10(13)11(9)15(17)18/h2-4,8H,5-7,13H2,1H3 |
| InChIKey | KRWGPEDBBRLCSR-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 123.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|