C9H11ClN4O4S — CID 62101682
6-chloro-N-(1,1-dioxothiolan-3-yl)-N-methyl-5-nitropyrimidin-4-amine (PubChem CID 62101682) has the molecular formula C9H11ClN4O4S and a molecular weight of 306.73 g/mol. Its IUPAC name is 6-chloro-N-(1,1-dioxothiolan-3-yl)-N-methyl-5-nitropyrimidin-4-amine.
| Compound Name | 6-chloro-N-(1,1-dioxothiolan-3-yl)-N-methyl-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 62101682 |
| Molecular Formula | C9H11ClN4O4S |
| Molecular Weight | 306.73 g/mol |
| Exact Mass | 306.02 |
| IUPAC Name | 6-chloro-N-(1,1-dioxothiolan-3-yl)-N-methyl-5-nitropyrimidin-4-amine |
| SMILES | CN(c1ncnc(Cl)c1[N+](=O)[O-])C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H11ClN4O4S/c1-13(6-2-3-19(17,18)4-6)9-7(14(15)16)8(10)11-5-12-9/h5-6H,2-4H2,1H3 |
| InChIKey | MKMFHMYAGYFDPY-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 106.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.73 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|