C12H21N5O2S — CID 80899134
N-(1,1-dioxothiolan-3-yl)-6-hydrazinyl-N-methyl-5-propylpyrimidin-4-amine (PubChem CID 80899134) has the molecular formula C12H21N5O2S and a molecular weight of 299.40 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-6-hydrazinyl-N-methyl-5-propylpyrimidin-4-amine.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-6-hydrazinyl-N-methyl-5-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80899134 |
| Molecular Formula | C12H21N5O2S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-6-hydrazinyl-N-methyl-5-propylpyrimidin-4-amine |
| SMILES | CCCc1c(NN)ncnc1N(C)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H21N5O2S/c1-3-4-10-11(16-13)14-8-15-12(10)17(2)9-5-6-20(18,19)7-9/h8-9H,3-7,13H2,1-2H3,(H,14,15,16) |
| InChIKey | RLYAFAXVWOKNBL-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|