C9H17N5 — CID 80932720
6-hydrazinyl-N,N-dimethyl-5-propylpyrimidin-4-amine (PubChem CID 80932720) has the molecular formula C9H17N5 and a molecular weight of 195.27 g/mol. Its IUPAC name is 6-hydrazinyl-N,N-dimethyl-5-propylpyrimidin-4-amine.
| Compound Name | 6-hydrazinyl-N,N-dimethyl-5-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80932720 |
| Molecular Formula | C9H17N5 |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.15 |
| IUPAC Name | 6-hydrazinyl-N,N-dimethyl-5-propylpyrimidin-4-amine |
| SMILES | CCCc1c(NN)ncnc1N(C)C |
| InChI | InChI=1S/C9H17N5/c1-4-5-7-8(13-10)11-6-12-9(7)14(2)3/h6H,4-5,10H2,1-3H3,(H,11,12,13) |
| InChIKey | BBDIMRUDJZODBO-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|