C16H23N5 — CID 80903906
N-ethyl-6-hydrazinyl-N-(4-methylphenyl)-5-propylpyrimidin-4-amine (PubChem CID 80903906) has the molecular formula C16H23N5 and a molecular weight of 285.40 g/mol. Its IUPAC name is N-ethyl-6-hydrazinyl-N-(4-methylphenyl)-5-propylpyrimidin-4-amine.
| Compound Name | N-ethyl-6-hydrazinyl-N-(4-methylphenyl)-5-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80903906 |
| Molecular Formula | C16H23N5 |
| Molecular Weight | 285.40 g/mol |
| Exact Mass | 285.20 |
| IUPAC Name | N-ethyl-6-hydrazinyl-N-(4-methylphenyl)-5-propylpyrimidin-4-amine |
| SMILES | CCCc1c(NN)ncnc1N(CC)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H23N5/c1-4-6-14-15(20-17)18-11-19-16(14)21(5-2)13-9-7-12(3)8-10-13/h7-11H,4-6,17H2,1-3H3,(H,18,19,20) |
| InChIKey | LRMAFDDVMCWPFW-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.40 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|