C15H22N6 — CID 80900573
N-ethyl-6-hydrazinyl-5-propyl-N-(pyridin-4-ylmethyl)pyrimidin-4-amine (PubChem CID 80900573) has the molecular formula C15H22N6 and a molecular weight of 286.38 g/mol. Its IUPAC name is N-ethyl-6-hydrazinyl-5-propyl-N-(pyridin-4-ylmethyl)pyrimidin-4-amine.
| Compound Name | N-ethyl-6-hydrazinyl-5-propyl-N-(pyridin-4-ylmethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80900573 |
| Molecular Formula | C15H22N6 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | N-ethyl-6-hydrazinyl-5-propyl-N-(pyridin-4-ylmethyl)pyrimidin-4-amine |
| SMILES | CCCc1c(NN)ncnc1N(CC)Cc1ccncc1 |
| InChI | InChI=1S/C15H22N6/c1-3-5-13-14(20-16)18-11-19-15(13)21(4-2)10-12-6-8-17-9-7-12/h6-9,11H,3-5,10,16H2,1-2H3,(H,18,19,20) |
| InChIKey | RZLPSUGUGWRLGK-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|