C16H17N5 — CID 64587906
4-N-ethyl-4-N-(pyridin-4-ylmethyl)quinazoline-4,6-diamine (PubChem CID 64587906) has the molecular formula C16H17N5 and a molecular weight of 279.35 g/mol. Its IUPAC name is 4-N-ethyl-4-N-(pyridin-4-ylmethyl)quinazoline-4,6-diamine.
| Compound Name | 4-N-ethyl-4-N-(pyridin-4-ylmethyl)quinazoline-4,6-diamine |
|---|---|
| PubChem CID | 64587906 |
| Molecular Formula | C16H17N5 |
| Molecular Weight | 279.35 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 4-N-ethyl-4-N-(pyridin-4-ylmethyl)quinazoline-4,6-diamine |
| SMILES | CCN(Cc1ccncc1)c1ncnc2ccc(N)cc12 |
| InChI | InChI=1S/C16H17N5/c1-2-21(10-12-5-7-18-8-6-12)16-14-9-13(17)3-4-15(14)19-11-20-16/h3-9,11H,2,10,17H2,1H3 |
| InChIKey | KIVJUGYWUYJDCL-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 67.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.35 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|